Online Database of Chemicals from Around the World
|
CAS#: 32857-41-3 Product: N-(4-Fluorophenyl)-N,N'-Dimethyl-N'-Phenyl-1,2-Ethanediamine No suppilers available for the product. |
| Name | N-(4-Fluorophenyl)-N,N'-Dimethyl-N'-Phenyl-1,2-Ethanediamine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.33 |
| CAS Registry Number | 32857-41-3 |
| SMILES | Fc2ccc(N(C)CCN(c1ccccc1)C)cc2 |
| InChI | 1S/C16H19FN2/c1-18(15-6-4-3-5-7-15)12-13-19(2)16-10-8-14(17)9-11-16/h3-11H,12-13H2,1-2H3 |
| InChIKey | HMZXGHUZOOEAFC-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.847°C at 760 mmHg (Cal.) |
| Flash point | 184.735°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Fluorophenyl)-N,N'-Dimethyl-N'-Phenyl-1,2-Ethanediamine |