Online Database of Chemicals from Around the World
|
CAS#: 3293-32-1 Product: 2,6-Di(Cyclohexylidene)Cyclohexan-1-One No suppilers available for the product. |
| Name | 2,6-Di(Cyclohexylidene)Cyclohexan-1-One |
|---|---|
| Synonyms | 2,6-Di(Cyclohexylidene)-1-Cyclohexanone; Smr000212862 |
| Molecular Structure |  |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 |
| CAS Registry Number | 3293-32-1 |
| EINECS | 221-956-7 |
| SMILES | O=C2[C](=[C]1CC[CH2]CC1)CCC[C]2=[C]3CC[CH2]CC3 |
| InChI | 1S/C18H26O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13H2 |
| InChIKey | UXLWGCCTUFJXDJ-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 2,6-Di(Cyclohexylidene)Cyclohexan-1-One |