Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(1,4-Cyclohexadien-1-Yl)-2,2,2-Trifluoroethanone |
|---|---|
| Synonyms | 1-(cyclohexa-1,4-dien-1-yl)-2,2,2-trifluoroethanone |
| Molecular Structure |  |
| Molecular Formula | C8H7F3O |
| Molecular Weight | 176.14 |
| CAS Registry Number | 329915-24-4 |
| SMILES | C1C=CCC(=C1)C(=O)C(F)(F)F |
| InChI | 1S/C8H7F3O/c9-8(10,11)7(12)6-4-2-1-3-5-6/h1-2,5H,3-4H2 |
| InChIKey | WXRNCOBGAGXIOF-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 137.918°C at 760 mmHg (Cal.) |
| Flash point | 51.037°C (Cal.) |
| Refractive index | 1.44 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,4-Cyclohexadien-1-Yl)-2,2,2-Trifluoroethanone |