Online Database of Chemicals from Around the World
|
CAS#: 3306-02-3 Product: (2-Phenyl-1-Cyclobutenyl)Benzene No suppilers available for the product. |
| Name | (2-Phenyl-1-Cyclobutenyl)Benzene |
|---|---|
| Synonyms | 1,1'-(1-Cyclobutene-1,2-Diyl)Bisbenzene; (2-Phenyl-1-Cyclobuten-1-Yl)Benzene; Benzene, 1,1'-(1-Cyclobutene-1,2-Diyl)Bis- |
| Molecular Structure |  |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 3306-02-3 |
| SMILES | C1=CC=C(C=C1)C2=C(CC2)C3=CC=CC=C3 |
| InChI | 1S/C16H14/c1-3-7-13(8-4-1)15-11-12-16(15)14-9-5-2-6-10-14/h1-10H,11-12H2 |
| InChIKey | YGVYHUGLHHFGNN-UHFFFAOYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.573°C at 760 mmHg (Cal.) |
| Flash point | 157.843°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Phenyl-1-Cyclobutenyl)Benzene |