Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-(2-Sulfanylethyl)-1,3-Benzothiazole-2(3H)-Thione |
|---|---|
| Synonyms | 6-(2-mercaptoethyl)benzo[d]thiazole-2(3H)-thione |
| Molecular Structure |  |
| Molecular Formula | C9H9NS3 |
| Molecular Weight | 227.37 |
| CAS Registry Number | 33125-85-8 |
| SMILES | c1cc2c(cc1CCS)sc(=S)[nH]2 |
| InChI | 1S/C9H9NS3/c11-4-3-6-1-2-7-8(5-6)13-9(12)10-7/h1-2,5,11H,3-4H2,(H,10,12) |
| InChIKey | BNBPNJMVGIKSDI-UHFFFAOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.809°C at 760 mmHg (Cal.) |
| Flash point | 196.203°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Sulfanylethyl)-1,3-Benzothiazole-2(3H)-Thione |