Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Hydroxy-2,2,5,5-tetramethylimidazole-4-carboxylic acid sodium salt |
|---|---|
| Synonyms | 1-Hydroxy-2,2,5,5-Tetramethyl-Imidazole-4-Carboxylate; 1-Hydroxy-2,2,5,5-Tetramethyl-4-Imidazolecarboxylate; Zinc02168825 |
| Molecular Structure |  |
| Molecular Formula | C8H13N2O3 |
| Molecular Weight | 185.20 |
| CAS Registry Number | 33156-75-1 |
| SMILES | CC1(N(O)C(N=C1C([O-])=O)(C)C)C |
| InChI | 1S/C8H14N2O3/c1-7(2)5(6(11)12)9-8(3,4)10(7)13/h13H,1-4H3,(H,11,12)/p-1 |
| InChIKey | DGYMEVWEYOKZDT-UHFFFAOYSA-M |
| Boiling point | 328.369°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Hydroxy-2,2,5,5-tetramethylimidazole-4-carboxylic acid sodium salt |