Online Database of Chemicals from Around the World
|
CAS#: 33281-23-1 Product: (17alpha,21beta)-A'-Neogammacerane No suppilers available for the product. |
| Name | (17alpha,21beta)-A'-Neogammacerane |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.74 |
| CAS Registry Number | 33281-23-1 |
| SMILES | [C@@]34([C@]2([C@@H]([C@@]1([C@H](C(CCC1)(C)C)CC2)C)CC[C@@H]3[C@@]5([C@H](CC4)C(CC5)C(C)C)C)C)C |
| InChI | 1S/C30H52/c1-20(2)21-12-17-27(5)22(21)13-18-29(7)24(27)10-11-25-28(6)16-9-15-26(3,4)23(28)14-19-30(25,29)8/h20-25H,9-19H2,1-8H3/t21?,22-,23+,24-,25-,27+,28+,29-,30-/m1/s1 |
| InChIKey | ZRLNBWWGLOPJIC-DXPMPHSRSA-N |
| Density | 0.925g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.407°C at 760 mmHg (Cal.) |
| Flash point | 221.837°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (17alpha,21beta)-A'-Neogammacerane |