Online Database of Chemicals from Around the World
|
CAS#: 33330-89-1 Product: 2-Dimethylaminodiazenylbenzamide No suppilers available for the product. |
| Name | 2-Dimethylaminodiazenylbenzamide |
|---|---|
| Synonyms | 2-Dimethylaminoazobenzamide; Benzamide, O-(3,3-Dimethyltriazeno)-; Nsc 136896 |
| Molecular Structure |  |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 |
| CAS Registry Number | 33330-89-1 |
| SMILES | C1=CC=CC(=C1N=NN(C)C)C(N)=O |
| InChI | 1S/C9H12N4O/c1-13(2)12-11-8-6-4-3-5-7(8)9(10)14/h3-6H,1-2H3,(H2,10,14) |
| InChIKey | BPIUKMIZYGZZRF-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.179°C at 760 mmHg (Cal.) |
| Flash point | 154.092°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Dimethylaminodiazenylbenzamide |