Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,4-Dimethylbenzo[g]Quinolin-2(1H)-One |
|---|---|
| Synonyms | 1,4-dimethylbenzo[g]quinolin-2(1H)-one |
| Molecular Structure | ![CAS#: 33333-84-5， 1,4-Dimethylbenzo[g]Quinolin-2(1H)-One](/moreStructures/33333-84-5.gif) |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 |
| CAS Registry Number | 33333-84-5 |
| SMILES | C/C2=C/C(=O)N(C)c1cc3ccccc3cc12 |
| InChI | 1S/C15H13NO/c1-10-7-15(17)16(2)14-9-12-6-4-3-5-11(12)8-13(10)14/h3-9H,1-2H3 |
| InChIKey | WISLCOBDZBPRSI-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.293°C at 760 mmHg (Cal.) |
| Flash point | 168.882°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dimethylbenzo[g]Quinolin-2(1H)-One |