| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Proline derivatives |
|---|---|
| Name | Methyl 4,4-Difluoro-5-Oxo-L-Prolinate |
| Synonyms | (S)-methyl 4,4-difluoro-5-oxopyrrolidine-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7F2NO3 |
| Molecular Weight | 179.12 |
| CAS Registry Number | 333956-61-9 |
| SMILES | FC1(F)C(=O)N[C@H](C(=O)OC)C1 |
| InChI | 1S/C6H7F2NO3/c1-12-4(10)3-2-6(7,8)5(11)9-3/h3H,2H2,1H3,(H,9,11)/t3-/m0/s1 |
| InChIKey | ZLFJHCXQQPPTPF-VKHMYHEASA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.173°C at 760 mmHg (Cal.) |
| Flash point | 120.221°C (Cal.) |
| Refractive index | 1.433 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4,4-Difluoro-5-Oxo-L-Prolinate |