Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,4-Diacetyl-3-Oxoglutaric Anhydride |
|---|---|
| Synonyms | 3,5-Diacetyl-2,6-Dihydroxy-Pyran-4-One; 3,5-Diacetyl-2,6-Dihydroxy-4-Pyranone; 3,5-Diethanoyl-2,6-Dihydroxy-Pyran-4-One |
| Molecular Structure |  |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.16 |
| CAS Registry Number | 33524-89-9 |
| EINECS | 251-563-6 |
| SMILES | CC(=O)C1=C(OC(=C(C1=O)C(=O)C)O)O |
| InChI | 1S/C9H8O6/c1-3(10)5-7(12)6(4(2)11)9(14)15-8(5)13/h13-14H,1-2H3 |
| InChIKey | KCERJSHOPWCXJE-UHFFFAOYSA-N |
| Density | 1.644g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.306°C at 760 mmHg (Cal.) |
| Flash point | 193.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diacetyl-3-Oxoglutaric Anhydride |