|
CAS#: 3353-12-6 Product: 4-Methylpyrene No suppilers available for the product. |
| Name | 4-Methylpyrene |
|---|---|
| Synonyms | Pyrene, 4-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 3353-12-6 |
| EINECS | 222-120-4 |
| SMILES | C1=C4C3=C2C(=C1C)C=CC=C2C=CC3=CC=C4 |
| InChI | 1S/C17H12/c1-11-10-14-6-2-4-12-8-9-13-5-3-7-15(11)17(13)16(12)14/h2-10H,1H3 |
| InChIKey | IXAFAYIIDHDJHN-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.998°C at 760 mmHg (Cal.) |
| Flash point | 178.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylpyrene |