Online Database of Chemicals from Around the World
|
CAS#: 33531-64-5 Product: (1-Methylpyrrolidin-3-Yl) N-(2-Chloro-6-Methylphenyl)Carbamate No suppilers available for the product. |
| Name | (1-Methylpyrrolidin-3-Yl) N-(2-Chloro-6-Methylphenyl)Carbamate |
|---|---|
| Synonyms | (1-Methylpyrrolidin-3-Yl) N-(2-Chloro-6-Methyl-Phenyl)Carbamate; N-(2-Chloro-6-Methylphenyl)Carbamic Acid (1-Methyl-3-Pyrrolidinyl) Ester; N-(2-Chloro-6-Methyl-Phenyl)Carbamic Acid (1-Methylpyrrolidin-3-Yl) Ester |
| Molecular Structure |  |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 |
| CAS Registry Number | 33531-64-5 |
| SMILES | C1=CC=C(C(=C1C)NC(OC2CN(CC2)C)=O)Cl |
| InChI | 1S/C13H17ClN2O2/c1-9-4-3-5-11(14)12(9)15-13(17)18-10-6-7-16(2)8-10/h3-5,10H,6-8H2,1-2H3,(H,15,17) |
| InChIKey | NIQMFMMHMRRKLU-UHFFFAOYSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.762°C at 760 mmHg (Cal.) |
| Flash point | 150.816°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Methylpyrrolidin-3-Yl) N-(2-Chloro-6-Methylphenyl)Carbamate |