Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Azabicyclo[2.2.1]Hept-5-Ene-3,3-Dicarboxamide |
|---|---|
| Synonyms | 2-azabicyclo[2.2.1]hept-5-ene-3,3-dicarboxamide |
| Molecular Structure | ![CAS#: 33547-96-5， 2-Azabicyclo[2.2.1]Hept-5-Ene-3,3-Dicarboxamide](/moreStructures/33547-96-5.gif) |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 |
| CAS Registry Number | 33547-96-5 |
| SMILES | C1C2C=CC1NC2(C(=O)N)C(=O)N |
| InChI | 1S/C8H11N3O2/c9-6(12)8(7(10)13)4-1-2-5(3-4)11-8/h1-2,4-5,11H,3H2,(H2,9,12)(H2,10,13) |
| InChIKey | QONYPPPZXOSOTP-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 546.723°C at 760 mmHg (Cal.) |
| Flash point | 284.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Azabicyclo[2.2.1]Hept-5-Ene-3,3-Dicarboxamide |