Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Organic raw materials >> Organic fluorine compound >> Fluorotoluene series |
|---|---|
| Name | 4-Bromo-2,3,5,6-Tetrafluorotoluene |
| Synonyms | B178 |
| Molecular Structure |  |
| Molecular Formula | C7H3BrF4 |
| Molecular Weight | 243.00 |
| CAS Registry Number | 33564-68-0 |
| SMILES | CC1=C(F)C(=C(Br)C(=C1F)F)F |
| InChI | 1S/C7H3BrF4/c1-2-4(9)6(11)3(8)7(12)5(2)10/h1H3 |
| InChIKey | CXHWIERFOQRRTJ-UHFFFAOYSA-N |
| Density | 1.752g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.722°C at 760 mmHg (Cal.) |
| Flash point | 77.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2,3,5,6-Tetrafluorotoluene |