Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-trans-Phenylcyclohexane-(1R,2-cis)-Dicarboxylic Imide |
|---|---|
| Synonyms | (3Ar,5S,7As)-5-Phenyl-3A,4,5,6,7,7A-Hexahydroisoindole-1,3-Quinone; Zinc04262554 |
| Molecular Structure |  |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 |
| CAS Registry Number | 336185-25-2 |
| SMILES | [C@H]12C(NC([C@H]1CC[C@@H](C2)C3=CC=CC=C3)=O)=O |
| InChI | 1S/C14H15NO2/c16-13-11-7-6-10(8-12(11)14(17)15-13)9-4-2-1-3-5-9/h1-5,10-12H,6-8H2,(H,15,16,17)/t10-,11-,12+/m0/s1 |
| InChIKey | SHLALXCFPAKZHG-SDDRHHMPSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.069°C at 760 mmHg (Cal.) |
| Flash point | 180.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-trans-Phenylcyclohexane-(1R,2-cis)-Dicarboxylic Imide |