Online Database of Chemicals from Around the World
| Name | 1-(2,6-Dichlorophenyl)-N-Phenylmethanimine |
|---|---|
| Synonyms | 1-(2,6-Dichlorophenyl)-N-Phenyl-Methanimine; (2,6-Dichlorobenzylidene)-Phenyl-Amine; Aniline, N-(2,6-Dichlorobenzylidene)- |
| Molecular Structure |  |
| Molecular Formula | C13H9Cl2N |
| Molecular Weight | 250.13 |
| CAS Registry Number | 33629-92-4 |
| SMILES | C1=C(Cl)C(=C(Cl)C=C1)C=NC2=CC=CC=C2 |
| InChI | 1S/C13H9Cl2N/c14-12-7-4-8-13(15)11(12)9-16-10-5-2-1-3-6-10/h1-9H |
| InChIKey | RSMDSQMJKAEWPT-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.686°C at 760 mmHg (Cal.) |
| Flash point | 174.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,6-Dichlorophenyl)-N-Phenylmethanimine |
