Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Phenyl-4-Pyrimidinethiol |
|---|---|
| Synonyms | 2-phenylpyrimidine-4(1H)-thione; 4(1H)-Pyrimidinethione,2-phenyl- |
| Molecular Structure |  |
| Molecular Formula | C10H8N2S |
| Molecular Weight | 188.25 |
| CAS Registry Number | 33630-21-6 |
| SMILES | C1=CC=C(C=C1)C2=NC=CC(=N2)S |
| InChI | 1S/C10H8N2S/c13-9-6-7-11-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,12,13) |
| InChIKey | KTGIQHLZKVLKCB-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.7±23.0°C at 760 mmHg (Cal.) |
| Flash point | 98.1±22.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-4-Pyrimidinethiol |