Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N,N,2-Triphenyl-Acetamide |
|---|---|
| Synonyms | N,N,2-Tri(Phenyl)Ethanamide; Nsc97591; Zinc01226040 |
| Molecular Structure |  |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 |
| CAS Registry Number | 33675-70-6 |
| SMILES | C3=C(N(C1=CC=CC=C1)C(CC2=CC=CC=C2)=O)C=CC=C3 |
| InChI | 1S/C20H17NO/c22-20(16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | OJJDDQBPSFGSOH-UHFFFAOYSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.782°C at 760 mmHg (Cal.) |
| Flash point | 248.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N,2-Triphenyl-Acetamide |