Online Database of Chemicals from Around the World
|
CAS#: 33716-82-4 Product: 2-(3-Hydroxy-5-Methylphenoxy)-5-Methoxy-3-Methylphenol No suppilers available for the product. |
| Name | 2-(3-Hydroxy-5-Methylphenoxy)-5-Methoxy-3-Methylphenol |
|---|---|
| Synonyms | 2-(3-Hydroxy-5-Methyl-Phenoxy)-5-Methoxy-3-Methyl-Phenol; Megxm0_000353; Acon1_001039 |
| Molecular Structure |  |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 33716-82-4 |
| SMILES | C1=C(C(=C(C=C1OC)C)OC2=CC(=CC(=C2)C)O)O |
| InChI | 1S/C15H16O4/c1-9-4-11(16)7-13(5-9)19-15-10(2)6-12(18-3)8-14(15)17/h4-8,16-17H,1-3H3 |
| InChIKey | KXXZLMLLYMPYJE-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.87°C at 760 mmHg (Cal.) |
| Flash point | 201.078°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Hydroxy-5-Methylphenoxy)-5-Methoxy-3-Methylphenol |