|
CAS#: 33723-32-9 Product: 3-[(1S)-1-(2,3-Dimethoxyphenyl)-2-Nitroethyl]-1H-Indole No suppilers available for the product. |
| Name | 3-[(1S)-1-(2,3-Dimethoxyphenyl)-2-Nitroethyl]-1H-Indole |
|---|---|
| Synonyms | 3-[(1S)-1-(2,3-Dimethoxyphenyl)-2-Nitro-Ethyl]-1H-Indole; Zinc02432947 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 |
| CAS Registry Number | 33723-32-9 |
| SMILES | [C@H](C1=C[NH]C2=CC=CC=C12)(C3=C(OC)C(=CC=C3)OC)C[N+]([O-])=O |
| InChI | 1S/C18H18N2O4/c1-23-17-9-5-7-13(18(17)24-2)15(11-20(21)22)14-10-19-16-8-4-3-6-12(14)16/h3-10,15,19H,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | QSSRNEAHPFPSJZ-OAHLLOKOSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.653°C at 760 mmHg (Cal.) |
| Flash point | 279.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(1S)-1-(2,3-Dimethoxyphenyl)-2-Nitroethyl]-1H-Indole |