|
CAS#: 33723-33-0 Product: 3-[(1R)-1-(4-Methoxyphenyl)-2-Nitroethyl]-1H-Indole No suppilers available for the product. |
| Name | 3-[(1R)-1-(4-Methoxyphenyl)-2-Nitroethyl]-1H-Indole |
|---|---|
| Synonyms | 3-[(1R)-1-(4-Methoxyphenyl)-2-Nitro-Ethyl]-1H-Indole; Zinc00315955 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 |
| CAS Registry Number | 33723-33-0 |
| SMILES | [C@H](C1=C[NH]C2=C1C=CC=C2)(C3=CC=C(OC)C=C3)C[N+]([O-])=O |
| InChI | 1S/C17H16N2O3/c1-22-13-8-6-12(7-9-13)16(11-19(20)21)15-10-18-17-5-3-2-4-14(15)17/h2-10,16,18H,11H2,1H3/t16-/m1/s1 |
| InChIKey | BWZOHFWHBDXMRA-MRXNPFEDSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.589°C at 760 mmHg (Cal.) |
| Flash point | 267.433°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(1R)-1-(4-Methoxyphenyl)-2-Nitroethyl]-1H-Indole |