Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(Chloromethyl)-5-Methoxy-1,4-Benzoquinone |
|---|---|
| Synonyms | 2-(chloromethyl)-5-methoxycyclohexa-2,5-diene-1,4-dione |
| Molecular Structure |  |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59 |
| CAS Registry Number | 337470-99-2 |
| SMILES | O=C1/C=C(\C(=O)\C=C1\OC)CCl |
| InChI | 1S/C8H7ClO3/c1-12-8-3-6(10)5(4-9)2-7(8)11/h2-3H,4H2,1H3 |
| InChIKey | SRHYCDYZCPKALG-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.543°C at 760 mmHg (Cal.) |
| Flash point | 131.859°C (Cal.) |
| Refractive index | 1.526 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Chloromethyl)-5-Methoxy-1,4-Benzoquinone |