Online Database of Chemicals from Around the World
|
CAS#: 3376-50-9 Product: 2,4,6-Trimethylpyridine 1-oxide No suppilers available for the product. |
| Name | 2,4,6-Trimethylpyridine 1-oxide |
|---|---|
| Synonyms | 2,4,6-Trimethyl-1-Oxido-Pyridin-1-Ium; 2,4,6-Trimethylpyridine 1-Oxide |
| Molecular Structure |  |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 |
| CAS Registry Number | 3376-50-9 |
| EINECS | 222-169-1 |
| SMILES | C1=C(C=C([N+](=C1C)[O-])C)C |
| InChI | 1S/C8H11NO/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,1-3H3 |
| InChIKey | QBNLGSOBSNKMBN-UHFFFAOYSA-N |
| Density | 0.993g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.036°C at 760 mmHg (Cal.) |
| Flash point | 137.072°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trimethylpyridine 1-oxide |