Online Database of Chemicals from Around the World
|
CAS#: 33788-22-6 Product: 4,8-Dihydroxy-3-Methylisochroman-1-One No suppilers available for the product. |
| Name | 4,8-Dihydroxy-3-Methylisochroman-1-One |
|---|---|
| Synonyms | 4,8-Dihydroxy-3-Methyl-Isochroman-1-One; 4,8-Dihydroxy-3-Methyl-1-Isochromanone; 1H-2-Benzopyran-1-One, 3,4-Dihydro-4,8-Dihydroxy-3-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 33788-22-6 |
| SMILES | C1=C2C(=C(O)C=C1)C(OC(C2O)C)=O |
| InChI | 1S/C10H10O4/c1-5-9(12)6-3-2-4-7(11)8(6)10(13)14-5/h2-5,9,11-12H,1H3 |
| InChIKey | STSOHAOGZMLWFR-UHFFFAOYSA-N |
| Density | 1.395g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.199°C at 760 mmHg (Cal.) |
| Flash point | 177.104°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8-Dihydroxy-3-Methylisochroman-1-One |