Online Database of Chemicals from Around the World
| Name | 5-Bromo-1H-Inden-1-One |
|---|---|
| Synonyms | 5-Bromo-1H-inden-1-one; MFCD09842501 |
| Molecular Formula | C9H5BrO |
| Molecular Weight | 209.04 |
| CAS Registry Number | 338989-48-3 |
| SMILES | Brc1cc\2c(cc1)C(=O)/C=C/2 |
| InChI | 1S/C9H5BrO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h1-5H |
| InChIKey | GDISUFGKUMDDGG-UHFFFAOYSA-N |
| Density | 1.679g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.614°C at 760 mmHg (Cal.) |
| Flash point | 143.359°C (Cal.) |
| Refractive index | 1.658 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-1H-Inden-1-One |
