Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-[5-(2-Methoxyethoxy)Pyrimidin-2-Yl]Benzenesulfonamide |
|---|---|
| Synonyms | N-[5-(2-Methoxyethoxy)-2-Pyrimidinyl]Benzenesulfonamide; N-(5-{[2-(Methyloxy)Ethyl]Oxy}Pyrimidin-2-Yl)Benzenesulfonamide; 2-Benzolsulfonamido-5-Beta-Methoxy-Aethoxy-Pyrimidine [German] |
| Molecular Structure | ![CAS#: 339-44-6， N-[5-(2-Methoxyethoxy)Pyrimidin-2-Yl]Benzenesulfonamide](/moreStructures/339-44-6.gif) |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.34 |
| CAS Registry Number | 339-44-6 |
| EINECS | 206-426-5 |
| SMILES | C1=CC=CC=C1[S](NC2=NC=C(C=N2)OCCOC)(=O)=O |
| InChI | 1S/C13H15N3O4S/c1-19-7-8-20-11-9-14-13(15-10-11)16-21(17,18)12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3,(H,14,15,16) |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.1±56.0°C at 760 mmHg (Cal.) |
| Flash point | 265.4±31.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[5-(2-Methoxyethoxy)Pyrimidin-2-Yl]Benzenesulfonamide |