|
CAS#: 339181-24-7 Product: N-[3,5-Bis(Trifluoromethyl)Phenyl]-2-(Isobutylsulfanyl)Isonicotinamide No suppilers available for the product. |
| Name | N-[3,5-Bis(Trifluoromethyl)Phenyl]-2-(Isobutylsulfanyl)Isonicotinamide |
|---|---|
| Synonyms | N-[3,5-Bi |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16F6N2OS |
| Molecular Weight | 422.39 |
| CAS Registry Number | 339181-24-7 |
| SMILES | CC(C)CSc1cc(ccn1)C(=O)Nc2cc(cc(c2)C(F)(F)F)C(F)(F)F |
| InChI | 1S/C18H16F6N2OS/c1-10(2)9-28-15-5-11(3-4-25-15)16(27)26-14-7-12(17(19,20)21)6-13(8-14)18(22,23)24/h3-8,10H,9H2,1-2H3,(H,26,27) |
| InChIKey | VJJMUYPIUPWGNJ-UHFFFAOYSA-N |
| Density | 1.38g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.62°C at 760 mmHg (Cal.) |
| Flash point | 179.155°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[3,5-Bis(Trifluoromethyl)Phenyl]-2-(Isobutylsulfanyl)Isonicotinamide |