Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-(2-Chlorophenyl)-2-Ethoxy-Acetamidoxime |
|---|---|
| Synonyms | 2-(2-Chlorophenyl)-2-Ethoxy-N'-Hydroxy-Acetamidine; 2-(2-Chlorophenyl)-2-Ethoxy-N'-Hydroxyacetamidine; 2-(2-Chlorophenyl)-2-Ethoxy-N'-Hydroxy-Ethanimidamide |
| Molecular Structure |  |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 |
| CAS Registry Number | 33954-75-5 |
| SMILES | C1=C(C(OCC)/C(=N/O)N)C(=CC=C1)Cl |
| InChI | 1S/C10H13ClN2O2/c1-2-15-9(10(12)13-14)7-5-3-4-6-8(7)11/h3-6,9,14H,2H2,1H3,(H2,12,13) |
| InChIKey | PTAMVVGINUXBPU-UHFFFAOYSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.382°C at 760 mmHg (Cal.) |
| Flash point | 179.011°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Chlorophenyl)-2-Ethoxy-Acetamidoxime |