Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Acetyl-Sec-Heptylsulfonyl Peroxide |
|---|---|
| Synonyms | Peroxyacetic Acid 1-Methylhexylsulfonyl Ester; Acetyl-Sec-Heptylsulphonyl Peroxide |
| Molecular Structure |  |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.30 |
| CAS Registry Number | 33970-43-3 |
| EINECS | 251-768-0 |
| SMILES | C(C([S](OOC(=O)C)(=O)=O)C)CCCC |
| InChI | 1S/C9H18O5S/c1-4-5-6-7-8(2)15(11,12)14-13-9(3)10/h8H,4-7H2,1-3H3 |
| InChIKey | WRUWUYLNUMCQJL-UHFFFAOYSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.795°C at 760 mmHg (Cal.) |
| Flash point | 135.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetyl-Sec-Heptylsulfonyl Peroxide |