Online Database of Chemicals from Around the World
|
CAS#: 3407-98-5 Product: 3-Chloroacridin-9-Amine No suppilers available for the product. |
| Name | 3-Chloroacridin-9-Amine |
|---|---|
| Synonyms | 3-Chloro-9-Acridinamine; (3-Chloroacridin-9-Yl)Amine; 5-Amino-2-Chloroacridine |
| Molecular Structure |  |
| Molecular Formula | C13H9ClN2 |
| Molecular Weight | 228.68 |
| CAS Registry Number | 3407-98-5 |
| SMILES | C2=C(Cl)C=CC3=C(N)C1=CC=CC=C1N=C23 |
| InChI | 1S/C13H9ClN2/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15/h1-7H,(H2,15,16) |
| InChIKey | IRSNBSGPKPZUDV-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 443.779°C at 760 mmHg (Cal.) |
| Flash point | 222.19°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloroacridin-9-Amine |