Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[4-(Chloroacetyl)Phenyl]Acetamide |
|---|---|
| Synonyms | 2-(4-(2-chloroacetyl)phenyl)acetamide; BENZENEACETAMIDE,4-(2-CHLOROACETYL)- |
| Molecular Structure | ![CAS#: 342413-41-6， 2-[4-(Chloroacetyl)Phenyl]Acetamide](/moreStructures/342413-41-6.gif) |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.64 |
| CAS Registry Number | 342413-41-6 |
| SMILES | O=C(N)Cc1ccc(cc1)C(=O)CCl |
| InChI | 1S/C10H10ClNO2/c11-6-9(13)8-3-1-7(2-4-8)5-10(12)14/h1-4H,5-6H2,(H2,12,14) |
| InChIKey | PZWJTWYSWVMFRO-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.774°C at 760 mmHg (Cal.) |
| Flash point | 224.001°C (Cal.) |
| Refractive index | 1.567 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(Chloroacetyl)Phenyl]Acetamide |