|
CAS#: 3425-72-7 Product: 2-Phenylpropan-2-Yl Acetate No suppilers available for the product. |
| Name | 2-Phenylpropan-2-Yl Acetate |
|---|---|
| Synonyms | (1-Methyl-1-Phenyl-Ethyl) Acetate; Acetic Acid (1-Methyl-1-Phenylethyl) Ester; Acetic Acid (1-Methyl-1-Phenyl-Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 3425-72-7 |
| EINECS | 222-322-2 |
| SMILES | C1=CC=C(C=C1)C(OC(=O)C)(C)C |
| InChI | 1S/C11H14O2/c1-9(12)13-11(2,3)10-7-5-4-6-8-10/h4-8H,1-3H3 |
| InChIKey | XPMMKIYJJWQFOR-UHFFFAOYSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.503°C at 760 mmHg (Cal.) |
| Flash point | 90.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylpropan-2-Yl Acetate |