Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-(4-Propan-2-Ylphenyl)Propanal |
|---|---|
| Synonyms | 2-(4-Isopropylphenyl)Propanal; 2-(4-Isopropylphenyl)Propionaldehyde; Benzeneacetaldehyde, Alpha-Methyl-4-(1-Methylethyl)- |
| Molecular Structure |  |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 34291-99-1 |
| EINECS | 251-920-6 |
| SMILES | C1=C(C=CC(=C1)C(C)C)C(C=O)C |
| InChI | 1S/C12H16O/c1-9(2)11-4-6-12(7-5-11)10(3)8-13/h4-10H,1-3H3 |
| InChIKey | IZQUWQPXCQLTJY-UHFFFAOYSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.536°C at 760 mmHg (Cal.) |
| Flash point | 110.902°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Propan-2-Ylphenyl)Propanal |