Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Ene-2-Carbonyl Chloride |
|---|---|
| Synonyms | 1,7,7-trimethylbicyclo[2.2.1]hept-2-ene-2-carbonyl chloride |
| Molecular Structure | ![CAS#: 343791-90-2， 1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Ene-2-Carbonyl Chloride](/moreStructures/343791-90-2.gif) |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 |
| CAS Registry Number | 343791-90-2 |
| SMILES | CC1(C2CCC1(C(=C2)C(=O)Cl)C)C |
| InChI | 1S/C11H15ClO/c1-10(2)7-4-5-11(10,3)8(6-7)9(12)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | PTMPIEVLODHTOJ-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.303°C at 760 mmHg (Cal.) |
| Flash point | 103.61°C (Cal.) |
| Refractive index | 1.518 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Ene-2-Carbonyl Chloride |