Online Database of Chemicals from Around the World
|
CAS#: 34425-60-0 Product: 1,8-Dihydroxy-2-Methyl-9,10-Anthraquinone No suppilers available for the product. |
| Name | 1,8-Dihydroxy-2-Methyl-9,10-Anthraquinone |
|---|---|
| Synonyms | 1,8-Dihydroxy-2-methyl-anthraquinone |
| Molecular Structure |  |
| Molecular Formula | C15H10O4 |
| Molecular Weight | 254.24 |
| CAS Registry Number | 34425-60-0 |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C3=C(C2=O)C(=CC=C3)O)O |
| InChI | 1S/C15H10O4/c1-7-5-6-9-12(13(7)17)15(19)11-8(14(9)18)3-2-4-10(11)16/h2-6,16-17H,1H3 |
| InChIKey | OGURMTXRUQGVMS-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.8±45.0°C at 760 mmHg (Cal.) |
| Flash point | 258.7±25.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dihydroxy-2-Methyl-9,10-Anthraquinone |