Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Amino-4-(3-Hydroxyphenyl)-1H-Pyrrole-3-Carbonitrile |
|---|---|
| Synonyms | 2-Amino-4-(3-Hydroxyphenyl)-1H-Pyrrole-3-Carbonitrile |
| Molecular Structure |  |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 |
| CAS Registry Number | 344359-56-4 |
| SMILES | N#Cc1c(N)[nH]cc1c1cccc(c1)O |
| InChI | 1S/C11H9N3O/c12-5-9-10(6-14-11(9)13)7-2-1-3-8(15)4-7/h1-4,6,14-15H,13H2 |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-4-(3-Hydroxyphenyl)-1H-Pyrrole-3-Carbonitrile |