| BeLang Pharma Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.belangpharma.com | |||
![]() | +86 13885682355 | |||
![]() | info@belangpharma.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2019 | ||||
| chemBlink Standard supplier since 2019 | ||||
| Name | (+)-2-(2,6-Dichlorophenoxy)-propionic acid ethylester |
|---|---|
| Synonyms | ethyl 2-(2,6-dichlorophenoxy)propanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.12 |
| CAS Registry Number | 344559-34-8 |
| SMILES | CCOC(=O)C(C)OC1=C(C=CC=C1Cl)Cl |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.520, Calc.* |
| Boiling Point | 320.7±27.0 °C (760 mmHg), Calc.* |
| Flash Point | 125.0±22.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (+)-2-(2,6-Dichlorophenoxy)-propionic acid ethylester |