Online Database of Chemicals from Around the World
|
CAS#: 34522-69-5 Product: 5,7-Dibromoquinoline No suppilers available for the product. |
| Name | 5,7-Dibromoquinoline |
|---|---|
| Synonyms | Ccris 216 |
| Molecular Formula | C9H5Br2N |
| Molecular Weight | 286.95 |
| CAS Registry Number | 34522-69-5 |
| SMILES | C1=C(C=C2C(=C1Br)C=CC=N2)Br |
| InChI | 1S/C9H5Br2N/c10-6-4-8(11)7-2-1-3-12-9(7)5-6/h1-5H |
| InChIKey | VYTOCZMQXCNIPD-UHFFFAOYSA-N |
| Density | 1.924g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.555°C at 760 mmHg (Cal.) |
| Flash point | 163.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dibromoquinoline |