|
CAS#: 34576-90-4 Product: 3,4,6-Trichloro-1-Benzothiophene-2-Carboxylate No suppilers available for the product. |
| Name | 3,4,6-Trichloro-1-Benzothiophene-2-Carboxylate |
|---|---|
| Synonyms | 3,4,6-Trichlorobenzothiophene-2-Carboxylate; 3,4,6-Trichloro-2-Benzothiophenecarboxylate; Zinc02390393 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H2Cl3O2S |
| Molecular Weight | 280.53 |
| CAS Registry Number | 34576-90-4 |
| SMILES | C1=C(Cl)C=C(Cl)C2=C1SC(=C2Cl)C([O-])=O |
| InChI | 1S/C9H3Cl3O2S/c10-3-1-4(11)6-5(2-3)15-8(7(6)12)9(13)14/h1-2H,(H,13,14)/p-1 |
| InChIKey | WUTBSOJTMUNLCC-UHFFFAOYSA-M |
| Boiling point | 454.994°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 228.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,6-Trichloro-1-Benzothiophene-2-Carboxylate |