Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Methyl 2-[4-(2-Pyridyl)Phenyl]Acetate |
|---|---|
| Synonyms | methyl-2-(4-(pyridin-2-yl)phenyl)acetate; Methyl2-(4-(pyridin-2-yl)phenyl)acetate |
| Molecular Structure | ![CAS#: 348086-69-1， Methyl 2-[4-(2-Pyridyl)Phenyl]Acetate](/moreStructures/348086-69-1.gif) |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 348086-69-1 |
| SMILES | COC(=O)Cc1ccc(cc1)c2ccccn2 |
| InChI | 1S/C14H13NO2/c1-17-14(16)10-11-5-7-12(8-6-11)13-4-2-3-9-15-13/h2-9H,10H2,1H3 |
| InChIKey | NZYZPIFLGYZYJD-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.838°C at 760 mmHg (Cal.) |
| Flash point | 167.191°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-[4-(2-Pyridyl)Phenyl]Acetate |