| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Trimethylcolchicinic Acid |
| Synonyms | Prestwick2_000580; Oprea1_221824; Prestwick0_000580 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 |
| CAS Registry Number | 3482-37-9 |
| EINECS | 222-464-5 |
| SMILES | C1=C(C(=C(C2=C1CCC(C3=CC(=O)C(=CC=C23)O)N)OC)OC)OC |
| InChI | 1S/C19H21NO5/c1-23-16-8-10-4-6-13(20)12-9-15(22)14(21)7-5-11(12)17(10)19(25-3)18(16)24-2/h5,7-9,13H,4,6,20H2,1-3H3,(H,21,22) |
| InChIKey | IRVWPZRYDQROLU-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.034°C at 760 mmHg (Cal.) |
| Flash point | 334.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylcolchicinic Acid |