| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | API >> Inhibitor drug |
|---|---|
| Name | 2,2-dichloro-N-(3-chloro-4-fluorophenyl)acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl3FNO |
| Molecular Weight | 256.49 |
| CAS Registry Number | 349106-80-5 |
| SMILES | C1=CC(=C(C=C1NC(=O)C(Cl)Cl)Cl)F |
| Solubility | 57.87 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.596, Calc.* |
| Melting point | 136.18 °C |
| Boiling Point | 366.4±42.0 °C (760 mmHg), Calc.*, 364.46 °C |
| Flash Point | 175.4±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P271-P280-P302-P304-P305-P313-P332-P337-P338-P340-P351-P352 Details |
| Market Analysis Reports |
| List of Reports Available for 2,2-dichloro-N-(3-chloro-4-fluorophenyl)acetamide |