Online Database of Chemicals from Around the World
|
CAS#: 3495-26-9 Product: N-(4-Iodophenyl)-1-(3-Nitrophenyl)Methanimine No suppilers available for the product. |
| Name | N-(4-Iodophenyl)-1-(3-Nitrophenyl)Methanimine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C13H9IN2O2 |
| Molecular Weight | 352.13 |
| CAS Registry Number | 3495-26-9 |
| SMILES | c1cc(cc(c1)[N+](=O)[O-])C=Nc2ccc(cc2)I |
| InChI | 1S/C13H9IN2O2/c14-11-4-6-12(7-5-11)15-9-10-2-1-3-13(8-10)16(17)18/h1-9H |
| InChIKey | LKCMREMLEOKTFK-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.035°C at 760 mmHg (Cal.) |
| Flash point | 223.554°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(4-Iodophenyl)-1-(3-Nitrophenyl)Methanimine |