Online Database of Chemicals from Around the World
|
CAS#: 35079-97-1 Product: 5,6-Dihydroxy-5,6-Dihydrobenzo[b][1]Benzazepine-11-Carboxamide No suppilers available for the product. |
| Name | 5,6-Dihydroxy-5,6-Dihydrobenzo[b][1]Benzazepine-11-Carboxamide |
|---|---|
| Synonyms | 10,11-Dihydro-10,11-Dihydroxy-5H-Dibenzazepine-5-Carboxamide; C07495; Dihydroxycarbazepine |
| Molecular Structure | ![CAS#: 35079-97-1， 5,6-Dihydroxy-5,6-Dihydrobenzo[b][1]Benzazepine-11-Carboxamide](/moreStructures/35079-97-1.gif) |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 |
| CAS Registry Number | 35079-97-1 |
| SMILES | C1=CC=CC2=C1N(C3=C(C(O)C2O)C=CC=C3)C(=O)N |
| InChI | 1S/C15H14N2O3/c16-15(20)17-11-7-3-1-5-9(11)13(18)14(19)10-6-2-4-8-12(10)17/h1-8,13-14,18-19H,(H2,16,20) |
| InChIKey | PRGQOPPDPVELEG-UHFFFAOYSA-N |
| Density | 1.443g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.421°C at 760 mmHg (Cal.) |
| Flash point | 220.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dihydroxy-5,6-Dihydrobenzo[b][1]Benzazepine-11-Carboxamide |