| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(2-Methyl-2H-Tetrazol-5-Yl)Acetone |
|---|---|
| Synonyms | 2-(dihydroxymethyl)-2,5-dihydrofuran-2,5-diol; InChI=1/C5H8N4O/c1-4(10)3-5-6-8-9(2)7-5/h3H2,1-2H3 |
| Molecular Structure | ![]() |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.14 |
| CAS Registry Number | 350802-26-5 |
| SMILES | CC(=O)CC1=NN(N=N1)C |
| InChI | 1S/C5H8N4O/c1-4(10)3-5-6-8-9(2)7-5/h3H2,1-2H3 |
| InChIKey | NZPUQVPWOGVWLI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 125.7±27.9°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| (1) | Dietrich Moderhack, Dirk Decker and Bernhard Holtmann. Aromatic azapentalenes: 1H- and (mesoionic) 2H-pyrrolotetrazoles. Part 1. Synthesis and spectral characteristics, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 720. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methyl-2H-Tetrazol-5-Yl)Acetone |