Online Database of Chemicals from Around the World
|
CAS#: 35089-69-1 Product: 1-Nitro-2-Pentylguanidine No suppilers available for the product. |
| Name | 1-Nitro-2-Pentylguanidine |
|---|---|
| Synonyms | N-Amyl-N'-nitroguanidine; N-Nitro-N'-pentylguanidine; NSC 34700 |
| Molecular Structure |  |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 174.20 |
| CAS Registry Number | 35089-69-1 |
| SMILES | [O-][N+](=O)N/C(=N/CCCCC)N |
| InChI | 1S/C6H14N4O2/c1-2-3-4-5-8-6(7)9-10(11)12/h2-5H2,1H3,(H3,7,8,9) |
| InChIKey | KYKAFJZSZPUGFG-UHFFFAOYSA-N |
| Density | 1.246g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.831°C at 760 mmHg (Cal.) |
| Flash point | 133.924°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-2-Pentylguanidine |