Online Database of Chemicals from Around the World
|
CAS#: 351-65-5 Product: 4-(3,4-Difluorophenyl)Diazenyl-N,N-Dimethylaniline No suppilers available for the product. |
| Name | 4-(3,4-Difluorophenyl)Diazenyl-N,N-Dimethylaniline |
|---|---|
| Synonyms | 4-(3,4-Difluorophenyl)Azo-N,N-Dimethyl-Aniline; 4-(3,4-Difluorophenyl)Azo-N,N-Dimethylaniline; [4-(3,4-Difluorophenyl)Azophenyl]-Dimethyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C14H13F2N3 |
| Molecular Weight | 261.27 |
| CAS Registry Number | 351-65-5 |
| SMILES | C2=C(N=NC1=CC=C(C(=C1)F)F)C=CC(=C2)N(C)C |
| InChI | 1S/C14H13F2N3/c1-19(2)12-6-3-10(4-7-12)17-18-11-5-8-13(15)14(16)9-11/h3-9H,1-2H3 |
| InChIKey | KNSMUCVNITYESQ-UHFFFAOYSA-N |
| Density | 1.16g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.166°C at 760 mmHg (Cal.) |
| Flash point | 184.323°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3,4-Difluorophenyl)Diazenyl-N,N-Dimethylaniline |