Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Amino-2-Chloro-3-Methyl-1,4-Benzoquinone |
|---|---|
| Synonyms | 5-amino-2-chloro-3-methylcyclohexa-2,5-diene-1,4-dione |
| Molecular Structure |  |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.58 |
| CAS Registry Number | 351004-63-2 |
| SMILES | Cl\C1=C(\C(=O)\C(=C/C1=O)N)C |
| InChI | rd-copy-button" onmouseover="ClipboardCopyInit(this, |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.906°C at 760 mmHg (Cal.) |
| Flash point | 117.64°C (Cal.) |
| Refractive index | 1.575 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-2-Chloro-3-Methyl-1,4-Benzoquinone |