Online Database of Chemicals from Around the World
|
CAS#: 3527-07-9 Product: 2-Methoxy-5-(1-Phenyl-2-Propen-1-Yl)-1,4-Benzenediol No suppilers available for the product. |
| Name | 2-Methoxy-5-(1-Phenyl-2-Propen-1-Yl)-1,4-Benzenediol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 |
| CAS Registry Number | 3527-07-9 |
| SMILES | COC1=C(C=C(C(=C1)O)C(C=C)C2=CC=CC=C2)O |
| InChI | 1S/C16H16O3/c1-3-12(11-7-5-4-6-8-11)13-9-15(18)16(19-2)10-14(13)17/h3-10,12,17-18H,1H2,2H3 |
| InChIKey | OUERCVVUXKKXCW-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 224.9±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-5-(1-Phenyl-2-Propen-1-Yl)-1,4-Benzenediol |